About 1-but-2-ynylpyrazol-4-ol
1-but-2-ynylpyrazol-4-ol (PubChem CID 122240485) has the molecular formula C7H8N2O
and a molecular weight of 136.15 g/mol. Its IUPAC name is 1-but-2-ynylpyrazol-4-ol.
Molecular Properties
| Compound Name | 1-but-2-ynylpyrazol-4-ol |
| PubChem CID | 122240485 |
| Molecular Formula | C7H8N2O |
| Molecular Weight | 136.15 g/mol |
| Exact Mass | 136.06 |
| IUPAC Name | 1-but-2-ynylpyrazol-4-ol |
| SMILES | CC#CCn1cc(O)cn1 |
| InChI | InChI=1S/C7H8N2O/c1-2-3-4-9-6-7(10)5-8-9/h5-6,10H,4H2,1H3 |
| InChIKey | UWWAPHQVNKSPAM-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.15 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-but-2-ynylpyrazol-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-but-2-ynylpyrazol-4-ol?
The IUPAC name of 1-but-2-ynylpyrazol-4-ol (CID 122240485) is 1-but-2-ynylpyrazol-4-ol.
What is the SMILES notation for 1-but-2-ynylpyrazol-4-ol?
The canonical SMILES for 1-but-2-ynylpyrazol-4-ol is CC#CCn1cc(O)cn1.
What is the InChIKey of 1-but-2-ynylpyrazol-4-ol?
The InChIKey is UWWAPHQVNKSPAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O/c1-2-3-4-9-6-7(10)5-8-9/h5-6,10H,4H2,1H3.
What are the key properties of 1-but-2-ynylpyrazol-4-ol?
1-but-2-ynylpyrazol-4-ol has a molecular weight of 136.15 g/mol, XLogP of 0.61, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-but-2-ynylpyrazol-4-ol is sourced from PubChem (CID 122240485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).