C12H13N3O3 — CID 122240811
(E)-3-[1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]pyrazol-4-yl]prop-2-enoic acid (PubChem CID 122240811) has the molecular formula C12H13N3O3 and a molecular weight of 247.25 g/mol. Its IUPAC name is (E)-3-[1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]pyrazol-4-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]pyrazol-4-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 122240811 |
| Molecular Formula | C12H13N3O3 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | (E)-3-[1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]pyrazol-4-yl]prop-2-enoic acid |
| SMILES | Cc1noc(C)c1Cn1cc(/C=C/C(=O)O)cn1 |
| InChI | InChI=1S/C12H13N3O3/c1-8-11(9(2)18-14-8)7-15-6-10(5-13-15)3-4-12(16)17/h3-6H,7H2,1-2H3,(H,16,17)/b4-3+ |
| InChIKey | WYXGBALAZFLPHM-ONEGZZNKSA-N |
| XLogP | 1.63 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|