About 5-furo[3,2-c]pyridin-4-ylpent-4-yn-1-ol
5-furo[3,2-c]pyridin-4-ylpent-4-yn-1-ol (PubChem CID 122241639) has the molecular formula C12H11NO2
and a molecular weight of 201.23 g/mol. Its IUPAC name is 5-furo[3,2-c]pyridin-4-ylpent-4-yn-1-ol.
Molecular Properties
| Compound Name | 5-furo[3,2-c]pyridin-4-ylpent-4-yn-1-ol |
| PubChem CID | 122241639 |
| Molecular Formula | C12H11NO2 |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.08 |
| IUPAC Name | 5-furo[3,2-c]pyridin-4-ylpent-4-yn-1-ol |
| SMILES | OCCCC#Cc1nccc2occc12 |
| InChI | InChI=1S/C12H11NO2/c14-8-3-1-2-4-11-10-6-9-15-12(10)5-7-13-11/h5-7,9,14H,1,3,8H2 |
| InChIKey | TXCQBBDQOWYEMR-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-furo[3,2-c]pyridin-4-ylpent-4-yn-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-furo[3,2-c]pyridin-4-ylpent-4-yn-1-ol?
The IUPAC name of 5-furo[3,2-c]pyridin-4-ylpent-4-yn-1-ol (CID 122241639) is 5-furo[3,2-c]pyridin-4-ylpent-4-yn-1-ol.
What is the SMILES notation for 5-furo[3,2-c]pyridin-4-ylpent-4-yn-1-ol?
The canonical SMILES for 5-furo[3,2-c]pyridin-4-ylpent-4-yn-1-ol is OCCCC#Cc1nccc2occc12.
What is the InChIKey of 5-furo[3,2-c]pyridin-4-ylpent-4-yn-1-ol?
The InChIKey is TXCQBBDQOWYEMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NO2/c14-8-3-1-2-4-11-10-6-9-15-12(10)5-7-13-11/h5-7,9,14H,1,3,8H2.
What are the key properties of 5-furo[3,2-c]pyridin-4-ylpent-4-yn-1-ol?
5-furo[3,2-c]pyridin-4-ylpent-4-yn-1-ol has a molecular weight of 201.23 g/mol, XLogP of 1.95, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-furo[3,2-c]pyridin-4-ylpent-4-yn-1-ol is sourced from PubChem (CID 122241639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).