About 1-[3-(1,3-thiazol-2-yl)prop-2-ynyl]pyrrolidin-2-one
1-[3-(1,3-thiazol-2-yl)prop-2-ynyl]pyrrolidin-2-one (PubChem CID 122242070) has the molecular formula C10H10N2OS
and a molecular weight of 206.27 g/mol. Its IUPAC name is 1-[3-(1,3-thiazol-2-yl)prop-2-ynyl]pyrrolidin-2-one.
Molecular Properties
| Compound Name | 1-[3-(1,3-thiazol-2-yl)prop-2-ynyl]pyrrolidin-2-one |
| PubChem CID | 122242070 |
| Molecular Formula | C10H10N2OS |
| Molecular Weight | 206.27 g/mol |
| Exact Mass | 206.05 |
| IUPAC Name | 1-[3-(1,3-thiazol-2-yl)prop-2-ynyl]pyrrolidin-2-one |
| SMILES | O=C1CCCN1CC#Cc1nccs1 |
| InChI | InChI=1S/C10H10N2OS/c13-10-4-2-7-12(10)6-1-3-9-11-5-8-14-9/h5,8H,2,4,6-7H2 |
| InChIKey | KLROOAGNVFRUNG-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.27 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[3-(1,3-thiazol-2-yl)prop-2-ynyl]pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(1,3-thiazol-2-yl)prop-2-ynyl]pyrrolidin-2-one?
The IUPAC name of 1-[3-(1,3-thiazol-2-yl)prop-2-ynyl]pyrrolidin-2-one (CID 122242070) is 1-[3-(1,3-thiazol-2-yl)prop-2-ynyl]pyrrolidin-2-one.
What is the SMILES notation for 1-[3-(1,3-thiazol-2-yl)prop-2-ynyl]pyrrolidin-2-one?
The canonical SMILES for 1-[3-(1,3-thiazol-2-yl)prop-2-ynyl]pyrrolidin-2-one is O=C1CCCN1CC#Cc1nccs1.
What is the InChIKey of 1-[3-(1,3-thiazol-2-yl)prop-2-ynyl]pyrrolidin-2-one?
The InChIKey is KLROOAGNVFRUNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2OS/c13-10-4-2-7-12(10)6-1-3-9-11-5-8-14-9/h5,8H,2,4,6-7H2.
What are the key properties of 1-[3-(1,3-thiazol-2-yl)prop-2-ynyl]pyrrolidin-2-one?
1-[3-(1,3-thiazol-2-yl)prop-2-ynyl]pyrrolidin-2-one has a molecular weight of 206.27 g/mol, XLogP of 1.12, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(1,3-thiazol-2-yl)prop-2-ynyl]pyrrolidin-2-one is sourced from PubChem (CID 122242070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).