About 4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)but-3-yn-1-ol
4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)but-3-yn-1-ol (PubChem CID 122242422) has the molecular formula C10H9N3O
and a molecular weight of 187.20 g/mol. Its IUPAC name is 4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)but-3-yn-1-ol.
Molecular Properties
| Compound Name | 4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)but-3-yn-1-ol |
| PubChem CID | 122242422 |
| Molecular Formula | C10H9N3O |
| Molecular Weight | 187.20 g/mol |
| Exact Mass | 187.07 |
| IUPAC Name | 4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)but-3-yn-1-ol |
| SMILES | OCCC#Cc1ncnc2[nH]ccc12 |
| InChI | InChI=1S/C10H9N3O/c14-6-2-1-3-9-8-4-5-11-10(8)13-7-12-9/h4-5,7,14H,2,6H2,(H,11,12,13) |
| InChIKey | NDLBOMOENFPHQD-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.20 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)but-3-yn-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)but-3-yn-1-ol?
The IUPAC name of 4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)but-3-yn-1-ol (CID 122242422) is 4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)but-3-yn-1-ol.
What is the SMILES notation for 4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)but-3-yn-1-ol?
The canonical SMILES for 4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)but-3-yn-1-ol is OCCC#Cc1ncnc2[nH]ccc12.
What is the InChIKey of 4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)but-3-yn-1-ol?
The InChIKey is NDLBOMOENFPHQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N3O/c14-6-2-1-3-9-8-4-5-11-10(8)13-7-12-9/h4-5,7,14H,2,6H2,(H,11,12,13).
What are the key properties of 4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)but-3-yn-1-ol?
4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)but-3-yn-1-ol has a molecular weight of 187.20 g/mol, XLogP of 0.69, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)but-3-yn-1-ol is sourced from PubChem (CID 122242422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).