About 4-thieno[3,2-c]pyridin-4-ylbut-3-yn-1-ol
4-thieno[3,2-c]pyridin-4-ylbut-3-yn-1-ol (PubChem CID 122242435) has the molecular formula C11H9NOS
and a molecular weight of 203.27 g/mol. Its IUPAC name is 4-thieno[3,2-c]pyridin-4-ylbut-3-yn-1-ol.
Molecular Properties
| Compound Name | 4-thieno[3,2-c]pyridin-4-ylbut-3-yn-1-ol |
| PubChem CID | 122242435 |
| Molecular Formula | C11H9NOS |
| Molecular Weight | 203.27 g/mol |
| Exact Mass | 203.04 |
| IUPAC Name | 4-thieno[3,2-c]pyridin-4-ylbut-3-yn-1-ol |
| SMILES | OCCC#Cc1nccc2sccc12 |
| InChI | InChI=1S/C11H9NOS/c13-7-2-1-3-10-9-5-8-14-11(9)4-6-12-10/h4-6,8,13H,2,7H2 |
| InChIKey | MTNFNRXXELEHEN-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.27 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-thieno[3,2-c]pyridin-4-ylbut-3-yn-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-thieno[3,2-c]pyridin-4-ylbut-3-yn-1-ol?
The IUPAC name of 4-thieno[3,2-c]pyridin-4-ylbut-3-yn-1-ol (CID 122242435) is 4-thieno[3,2-c]pyridin-4-ylbut-3-yn-1-ol.
What is the SMILES notation for 4-thieno[3,2-c]pyridin-4-ylbut-3-yn-1-ol?
The canonical SMILES for 4-thieno[3,2-c]pyridin-4-ylbut-3-yn-1-ol is OCCC#Cc1nccc2sccc12.
What is the InChIKey of 4-thieno[3,2-c]pyridin-4-ylbut-3-yn-1-ol?
The InChIKey is MTNFNRXXELEHEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9NOS/c13-7-2-1-3-10-9-5-8-14-11(9)4-6-12-10/h4-6,8,13H,2,7H2.
What are the key properties of 4-thieno[3,2-c]pyridin-4-ylbut-3-yn-1-ol?
4-thieno[3,2-c]pyridin-4-ylbut-3-yn-1-ol has a molecular weight of 203.27 g/mol, XLogP of 2.03, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-thieno[3,2-c]pyridin-4-ylbut-3-yn-1-ol is sourced from PubChem (CID 122242435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).