About 3-(3,3-dimethylbut-1-ynyl)-6,7-dihydro-5H-cyclopenta[c]pyridazine
3-(3,3-dimethylbut-1-ynyl)-6,7-dihydro-5H-cyclopenta[c]pyridazine (PubChem CID 122242718) has the molecular formula C13H16N2
and a molecular weight of 200.28 g/mol. Its IUPAC name is 3-(3,3-dimethylbut-1-ynyl)-6,7-dihydro-5H-cyclopenta[c]pyridazine.
Molecular Properties
| Compound Name | 3-(3,3-dimethylbut-1-ynyl)-6,7-dihydro-5H-cyclopenta[c]pyridazine |
| PubChem CID | 122242718 |
| Molecular Formula | C13H16N2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | 3-(3,3-dimethylbut-1-ynyl)-6,7-dihydro-5H-cyclopenta[c]pyridazine |
| SMILES | CC(C)(C)C#Cc1cc2c(nn1)CCC2 |
| InChI | InChI=1S/C13H16N2/c1-13(2,3)8-7-11-9-10-5-4-6-12(10)15-14-11/h9H,4-6H2,1-3H3 |
| InChIKey | QKPZXGQSJXRUIM-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(3,3-dimethylbut-1-ynyl)-6,7-dihydro-5H-cyclopenta[c]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,3-dimethylbut-1-ynyl)-6,7-dihydro-5H-cyclopenta[c]pyridazine?
The IUPAC name of 3-(3,3-dimethylbut-1-ynyl)-6,7-dihydro-5H-cyclopenta[c]pyridazine (CID 122242718) is 3-(3,3-dimethylbut-1-ynyl)-6,7-dihydro-5H-cyclopenta[c]pyridazine.
What is the SMILES notation for 3-(3,3-dimethylbut-1-ynyl)-6,7-dihydro-5H-cyclopenta[c]pyridazine?
The canonical SMILES for 3-(3,3-dimethylbut-1-ynyl)-6,7-dihydro-5H-cyclopenta[c]pyridazine is CC(C)(C)C#Cc1cc2c(nn1)CCC2.
What is the InChIKey of 3-(3,3-dimethylbut-1-ynyl)-6,7-dihydro-5H-cyclopenta[c]pyridazine?
The InChIKey is QKPZXGQSJXRUIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2/c1-13(2,3)8-7-11-9-10-5-4-6-12(10)15-14-11/h9H,4-6H2,1-3H3.
What are the key properties of 3-(3,3-dimethylbut-1-ynyl)-6,7-dihydro-5H-cyclopenta[c]pyridazine?
3-(3,3-dimethylbut-1-ynyl)-6,7-dihydro-5H-cyclopenta[c]pyridazine has a molecular weight of 200.28 g/mol, XLogP of 2.36, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,3-dimethylbut-1-ynyl)-6,7-dihydro-5H-cyclopenta[c]pyridazine is sourced from PubChem (CID 122242718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).