About 4-imidazo[1,2-b]pyridazin-6-yl-2-methylbut-3-yn-2-ol
4-imidazo[1,2-b]pyridazin-6-yl-2-methylbut-3-yn-2-ol (PubChem CID 122243000) has the molecular formula C11H11N3O
and a molecular weight of 201.23 g/mol. Its IUPAC name is 4-imidazo[1,2-b]pyridazin-6-yl-2-methylbut-3-yn-2-ol.
Molecular Properties
| Compound Name | 4-imidazo[1,2-b]pyridazin-6-yl-2-methylbut-3-yn-2-ol |
| PubChem CID | 122243000 |
| Molecular Formula | C11H11N3O |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.09 |
| IUPAC Name | 4-imidazo[1,2-b]pyridazin-6-yl-2-methylbut-3-yn-2-ol |
| SMILES | CC(C)(O)C#Cc1ccc2nccn2n1 |
| InChI | InChI=1S/C11H11N3O/c1-11(2,15)6-5-9-3-4-10-12-7-8-14(10)13-9/h3-4,7-8,15H,1-2H3 |
| InChIKey | SSFFWVRLBAXFST-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 50.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-imidazo[1,2-b]pyridazin-6-yl-2-methylbut-3-yn-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-imidazo[1,2-b]pyridazin-6-yl-2-methylbut-3-yn-2-ol?
The IUPAC name of 4-imidazo[1,2-b]pyridazin-6-yl-2-methylbut-3-yn-2-ol (CID 122243000) is 4-imidazo[1,2-b]pyridazin-6-yl-2-methylbut-3-yn-2-ol.
What is the SMILES notation for 4-imidazo[1,2-b]pyridazin-6-yl-2-methylbut-3-yn-2-ol?
The canonical SMILES for 4-imidazo[1,2-b]pyridazin-6-yl-2-methylbut-3-yn-2-ol is CC(C)(O)C#Cc1ccc2nccn2n1.
What is the InChIKey of 4-imidazo[1,2-b]pyridazin-6-yl-2-methylbut-3-yn-2-ol?
The InChIKey is SSFFWVRLBAXFST-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N3O/c1-11(2,15)6-5-9-3-4-10-12-7-8-14(10)13-9/h3-4,7-8,15H,1-2H3.
What are the key properties of 4-imidazo[1,2-b]pyridazin-6-yl-2-methylbut-3-yn-2-ol?
4-imidazo[1,2-b]pyridazin-6-yl-2-methylbut-3-yn-2-ol has a molecular weight of 201.23 g/mol, XLogP of 0.85, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-imidazo[1,2-b]pyridazin-6-yl-2-methylbut-3-yn-2-ol is sourced from PubChem (CID 122243000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).