C16H14FN3O2 — CID 122244751
2-fluoro-N-[2-[4-(furan-3-yl)pyrazol-1-yl]ethyl]benzamide (PubChem CID 122244751) has the molecular formula C16H14FN3O2 and a molecular weight of 299.31 g/mol. Its IUPAC name is 2-fluoro-N-[2-[4-(furan-3-yl)pyrazol-1-yl]ethyl]benzamide.
| Compound Name | 2-fluoro-N-[2-[4-(furan-3-yl)pyrazol-1-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 122244751 |
| Molecular Formula | C16H14FN3O2 |
| Molecular Weight | 299.31 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | 2-fluoro-N-[2-[4-(furan-3-yl)pyrazol-1-yl]ethyl]benzamide |
| SMILES | O=C(NCCn1cc(-c2ccoc2)cn1)c1ccccc1F |
| InChI | InChI=1S/C16H14FN3O2/c17-15-4-2-1-3-14(15)16(21)18-6-7-20-10-13(9-19-20)12-5-8-22-11-12/h1-5,8-11H,6-7H2,(H,18,21) |
| InChIKey | LYZOBSCPBJAKSH-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 60.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.31 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |