About 2-cyclopropylsulfonyl-1,3-dihydroisoindole
2-cyclopropylsulfonyl-1,3-dihydroisoindole (PubChem CID 122244979) has the molecular formula C11H13NO2S
and a molecular weight of 223.30 g/mol. Its IUPAC name is 2-cyclopropylsulfonyl-1,3-dihydroisoindole.
Molecular Properties
| Compound Name | 2-cyclopropylsulfonyl-1,3-dihydroisoindole |
| PubChem CID | 122244979 |
| Molecular Formula | C11H13NO2S |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.07 |
| IUPAC Name | 2-cyclopropylsulfonyl-1,3-dihydroisoindole |
| SMILES | O=S(=O)(C1CC1)N1Cc2ccccc2C1 |
| InChI | InChI=1S/C11H13NO2S/c13-15(14,11-5-6-11)12-7-9-3-1-2-4-10(9)8-12/h1-4,11H,5-8H2 |
| InChIKey | YVTUADTXBBLZJV-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-cyclopropylsulfonyl-1,3-dihydroisoindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropylsulfonyl-1,3-dihydroisoindole?
The IUPAC name of 2-cyclopropylsulfonyl-1,3-dihydroisoindole (CID 122244979) is 2-cyclopropylsulfonyl-1,3-dihydroisoindole.
What is the SMILES notation for 2-cyclopropylsulfonyl-1,3-dihydroisoindole?
The canonical SMILES for 2-cyclopropylsulfonyl-1,3-dihydroisoindole is O=S(=O)(C1CC1)N1Cc2ccccc2C1.
What is the InChIKey of 2-cyclopropylsulfonyl-1,3-dihydroisoindole?
The InChIKey is YVTUADTXBBLZJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO2S/c13-15(14,11-5-6-11)12-7-9-3-1-2-4-10(9)8-12/h1-4,11H,5-8H2.
What are the key properties of 2-cyclopropylsulfonyl-1,3-dihydroisoindole?
2-cyclopropylsulfonyl-1,3-dihydroisoindole has a molecular weight of 223.30 g/mol, XLogP of 1.49, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropylsulfonyl-1,3-dihydroisoindole is sourced from PubChem (CID 122244979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).