C15H19N3O3 — CID 122246707
2-methoxy-N-[2-(2-pyrazol-1-ylethoxy)ethyl]benzamide (PubChem CID 122246707) has the molecular formula C15H19N3O3 and a molecular weight of 289.34 g/mol. Its IUPAC name is 2-methoxy-N-[2-(2-pyrazol-1-ylethoxy)ethyl]benzamide.
| Compound Name | 2-methoxy-N-[2-(2-pyrazol-1-ylethoxy)ethyl]benzamide |
|---|---|
| PubChem CID | 122246707 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 2-methoxy-N-[2-(2-pyrazol-1-ylethoxy)ethyl]benzamide |
| SMILES | COc1ccccc1C(=O)NCCOCCn1cccn1 |
| InChI | InChI=1S/C15H19N3O3/c1-20-14-6-3-2-5-13(14)15(19)16-8-11-21-12-10-18-9-4-7-17-18/h2-7,9H,8,10-12H2,1H3,(H,16,19) |
| InChIKey | ZYXLBPUZMWMKMZ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|