C16H13F3N2O3 — CID 122247415
(E)-3-(furan-2-yl)-1-[3-[[5-(trifluoromethyl)-2-pyridinyl]oxy]azetidin-1-yl]prop-2-en-1-one (PubChem CID 122247415) has the molecular formula C16H13F3N2O3 and a molecular weight of 338.29 g/mol. Its IUPAC name is (E)-3-(furan-2-yl)-1-[3-[[5-(trifluoromethyl)-2-pyridinyl]oxy]azetidin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(furan-2-yl)-1-[3-[[5-(trifluoromethyl)-2-pyridinyl]oxy]azetidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 122247415 |
| Molecular Formula | C16H13F3N2O3 |
| Molecular Weight | 338.29 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | (E)-3-(furan-2-yl)-1-[3-[[5-(trifluoromethyl)-2-pyridinyl]oxy]azetidin-1-yl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccco1)N1CC(Oc2ccc(C(F)(F)F)cn2)C1 |
| InChI | InChI=1S/C16H13F3N2O3/c17-16(18,19)11-3-5-14(20-8-11)24-13-9-21(10-13)15(22)6-4-12-2-1-7-23-12/h1-8,13H,9-10H2/b6-4+ |
| InChIKey | JVWNHGWCKCBHJE-GQCTYLIASA-N |
| XLogP | 3.00 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.29 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|