C15H19ClN2O2 — CID 122247872
[3-[(3-chloro-2-pyridinyl)oxy]azetidin-1-yl]-cyclohexylmethanone (PubChem CID 122247872) has the molecular formula C15H19ClN2O2 and a molecular weight of 294.78 g/mol. Its IUPAC name is [3-[(3-chloro-2-pyridinyl)oxy]azetidin-1-yl]-cyclohexylmethanone.
| Compound Name | [3-[(3-chloro-2-pyridinyl)oxy]azetidin-1-yl]-cyclohexylmethanone |
|---|---|
| PubChem CID | 122247872 |
| Molecular Formula | C15H19ClN2O2 |
| Molecular Weight | 294.78 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | [3-[(3-chloro-2-pyridinyl)oxy]azetidin-1-yl]-cyclohexylmethanone |
| SMILES | O=C(C1CCCCC1)N1CC(Oc2ncccc2Cl)C1 |
| InChI | InChI=1S/C15H19ClN2O2/c16-13-7-4-8-17-14(13)20-12-9-18(10-12)15(19)11-5-2-1-3-6-11/h4,7-8,11-12H,1-3,5-6,9-10H2 |
| InChIKey | HCGZPEGTLAPBQC-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.78 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |