C16H14Cl2N2O2 — CID 122248418
2-(2-chlorophenyl)-1-[3-[(5-chloro-2-pyridinyl)oxy]azetidin-1-yl]ethanone (PubChem CID 122248418) has the molecular formula C16H14Cl2N2O2 and a molecular weight of 337.21 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-1-[3-[(5-chloro-2-pyridinyl)oxy]azetidin-1-yl]ethanone.
| Compound Name | 2-(2-chlorophenyl)-1-[3-[(5-chloro-2-pyridinyl)oxy]azetidin-1-yl]ethanone |
|---|---|
| PubChem CID | 122248418 |
| Molecular Formula | C16H14Cl2N2O2 |
| Molecular Weight | 337.21 g/mol |
| Exact Mass | 336.04 |
| IUPAC Name | 2-(2-chlorophenyl)-1-[3-[(5-chloro-2-pyridinyl)oxy]azetidin-1-yl]ethanone |
| SMILES | O=C(Cc1ccccc1Cl)N1CC(Oc2ccc(Cl)cn2)C1 |
| InChI | InChI=1S/C16H14Cl2N2O2/c17-12-5-6-15(19-8-12)22-13-9-20(10-13)16(21)7-11-3-1-2-4-14(11)18/h1-6,8,13H,7,9-10H2 |
| InChIKey | BGVBLWRNKPNWKG-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.21 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |