C16H17ClN2O3S — CID 122248543
5-chloro-2-[1-(2,4-dimethylphenyl)sulfonylazetidin-3-yl]oxypyridine (PubChem CID 122248543) has the molecular formula C16H17ClN2O3S and a molecular weight of 352.84 g/mol. Its IUPAC name is 5-chloro-2-[1-(2,4-dimethylphenyl)sulfonylazetidin-3-yl]oxypyridine.
| Compound Name | 5-chloro-2-[1-(2,4-dimethylphenyl)sulfonylazetidin-3-yl]oxypyridine |
|---|---|
| PubChem CID | 122248543 |
| Molecular Formula | C16H17ClN2O3S |
| Molecular Weight | 352.84 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | 5-chloro-2-[1-(2,4-dimethylphenyl)sulfonylazetidin-3-yl]oxypyridine |
| SMILES | Cc1ccc(S(=O)(=O)N2CC(Oc3ccc(Cl)cn3)C2)c(C)c1 |
| InChI | InChI=1S/C16H17ClN2O3S/c1-11-3-5-15(12(2)7-11)23(20,21)19-9-14(10-19)22-16-6-4-13(17)8-18-16/h3-8,14H,9-10H2,1-2H3 |
| InChIKey | UBBYAMFIDCHPKH-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.84 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |