C13H13N3O4 — CID 122248678
ethyl 2-[3-[(5-cyano-2-pyridinyl)oxy]azetidin-1-yl]-2-oxoacetate (PubChem CID 122248678) has the molecular formula C13H13N3O4 and a molecular weight of 275.26 g/mol. Its IUPAC name is ethyl 2-[3-[(5-cyano-2-pyridinyl)oxy]azetidin-1-yl]-2-oxoacetate.
| Compound Name | ethyl 2-[3-[(5-cyano-2-pyridinyl)oxy]azetidin-1-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 122248678 |
| Molecular Formula | C13H13N3O4 |
| Molecular Weight | 275.26 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | ethyl 2-[3-[(5-cyano-2-pyridinyl)oxy]azetidin-1-yl]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)N1CC(Oc2ccc(C#N)cn2)C1 |
| InChI | InChI=1S/C13H13N3O4/c1-2-19-13(18)12(17)16-7-10(8-16)20-11-4-3-9(5-14)6-15-11/h3-4,6,10H,2,7-8H2,1H3 |
| InChIKey | FEZLLRUGNZIVIM-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 92.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.26 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|