C12H13N3O3 — CID 122249189
ethyl 3-[(3-cyano-2-pyridinyl)oxy]azetidine-1-carboxylate (PubChem CID 122249189) has the molecular formula C12H13N3O3 and a molecular weight of 247.25 g/mol. Its IUPAC name is ethyl 3-[(3-cyano-2-pyridinyl)oxy]azetidine-1-carboxylate.
| Compound Name | ethyl 3-[(3-cyano-2-pyridinyl)oxy]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 122249189 |
| Molecular Formula | C12H13N3O3 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | ethyl 3-[(3-cyano-2-pyridinyl)oxy]azetidine-1-carboxylate |
| SMILES | CCOC(=O)N1CC(Oc2ncccc2C#N)C1 |
| InChI | InChI=1S/C12H13N3O3/c1-2-17-12(16)15-7-10(8-15)18-11-9(6-13)4-3-5-14-11/h3-5,10H,2,7-8H2,1H3 |
| InChIKey | AZPTUTYJJJPDSE-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 75.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |