About 5,7-ditert-butyl-2-pyridin-3-yl-1,3-benzoxazole
5,7-ditert-butyl-2-pyridin-3-yl-1,3-benzoxazole (PubChem CID 1222503) has the molecular formula C20H24N2O
and a molecular weight of 308.43 g/mol. Its IUPAC name is 5,7-ditert-butyl-2-pyridin-3-yl-1,3-benzoxazole.
Molecular Properties
| Compound Name | 5,7-ditert-butyl-2-pyridin-3-yl-1,3-benzoxazole |
| PubChem CID | 1222503 |
| Molecular Formula | C20H24N2O |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.19 |
| IUPAC Name | 5,7-ditert-butyl-2-pyridin-3-yl-1,3-benzoxazole |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c2oc(-c3cccnc3)nc2c1 |
| InChI | InChI=1S/C20H24N2O/c1-19(2,3)14-10-15(20(4,5)6)17-16(11-14)22-18(23-17)13-8-7-9-21-12-13/h7-12H,1-6H3 |
| InChIKey | DGCDAPCHBMZLKG-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5,7-ditert-butyl-2-pyridin-3-yl-1,3-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-ditert-butyl-2-pyridin-3-yl-1,3-benzoxazole?
The IUPAC name of 5,7-ditert-butyl-2-pyridin-3-yl-1,3-benzoxazole (CID 1222503) is 5,7-ditert-butyl-2-pyridin-3-yl-1,3-benzoxazole.
What is the SMILES notation for 5,7-ditert-butyl-2-pyridin-3-yl-1,3-benzoxazole?
The canonical SMILES for 5,7-ditert-butyl-2-pyridin-3-yl-1,3-benzoxazole is CC(C)(C)c1cc(C(C)(C)C)c2oc(-c3cccnc3)nc2c1.
What is the InChIKey of 5,7-ditert-butyl-2-pyridin-3-yl-1,3-benzoxazole?
The InChIKey is DGCDAPCHBMZLKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24N2O/c1-19(2,3)14-10-15(20(4,5)6)17-16(11-14)22-18(23-17)13-8-7-9-21-12-13/h7-12H,1-6H3.
What are the key properties of 5,7-ditert-butyl-2-pyridin-3-yl-1,3-benzoxazole?
5,7-ditert-butyl-2-pyridin-3-yl-1,3-benzoxazole has a molecular weight of 308.43 g/mol, XLogP of 5.48, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-ditert-butyl-2-pyridin-3-yl-1,3-benzoxazole is sourced from PubChem (CID 1222503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).