C14H16ClF3N2O2 — CID 122250787
3-chloro-2,2-dimethyl-1-[3-[[3-(trifluoromethyl)-2-pyridinyl]oxy]azetidin-1-yl]propan-1-one (PubChem CID 122250787) has the molecular formula C14H16ClF3N2O2 and a molecular weight of 336.74 g/mol. Its IUPAC name is 3-chloro-2,2-dimethyl-1-[3-[[3-(trifluoromethyl)-2-pyridinyl]oxy]azetidin-1-yl]propan-1-one.
| Compound Name | 3-chloro-2,2-dimethyl-1-[3-[[3-(trifluoromethyl)-2-pyridinyl]oxy]azetidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 122250787 |
| Molecular Formula | C14H16ClF3N2O2 |
| Molecular Weight | 336.74 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | 3-chloro-2,2-dimethyl-1-[3-[[3-(trifluoromethyl)-2-pyridinyl]oxy]azetidin-1-yl]propan-1-one |
| SMILES | CC(C)(CCl)C(=O)N1CC(Oc2ncccc2C(F)(F)F)C1 |
| InChI | InChI=1S/C14H16ClF3N2O2/c1-13(2,8-15)12(21)20-6-9(7-20)22-11-10(14(16,17)18)4-3-5-19-11/h3-5,9H,6-8H2,1-2H3 |
| InChIKey | ICUGIOLAKCGEKL-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.74 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|