C14H12F3N3O2S — CID 122251065
N-thiophen-2-yl-3-[[3-(trifluoromethyl)-2-pyridinyl]oxy]azetidine-1-carboxamide (PubChem CID 122251065) has the molecular formula C14H12F3N3O2S and a molecular weight of 343.33 g/mol. Its IUPAC name is N-thiophen-2-yl-3-[[3-(trifluoromethyl)-2-pyridinyl]oxy]azetidine-1-carboxamide.
| Compound Name | N-thiophen-2-yl-3-[[3-(trifluoromethyl)-2-pyridinyl]oxy]azetidine-1-carboxamide |
|---|---|
| PubChem CID | 122251065 |
| Molecular Formula | C14H12F3N3O2S |
| Molecular Weight | 343.33 g/mol |
| Exact Mass | 343.06 |
| IUPAC Name | N-thiophen-2-yl-3-[[3-(trifluoromethyl)-2-pyridinyl]oxy]azetidine-1-carboxamide |
| SMILES | O=C(Nc1cccs1)N1CC(Oc2ncccc2C(F)(F)F)C1 |
| InChI | InChI=1S/C14H12F3N3O2S/c15-14(16,17)10-3-1-5-18-12(10)22-9-7-20(8-9)13(21)19-11-4-2-6-23-11/h1-6,9H,7-8H2,(H,19,21) |
| InChIKey | ZUXGESVZGIECAW-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.33 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |