C15H17F3N2O3 — CID 122251519
oxan-4-yl-[3-[[4-(trifluoromethyl)-2-pyridinyl]oxy]azetidin-1-yl]methanone (PubChem CID 122251519) has the molecular formula C15H17F3N2O3 and a molecular weight of 330.31 g/mol. Its IUPAC name is oxan-4-yl-[3-[[4-(trifluoromethyl)-2-pyridinyl]oxy]azetidin-1-yl]methanone.
| Compound Name | oxan-4-yl-[3-[[4-(trifluoromethyl)-2-pyridinyl]oxy]azetidin-1-yl]methanone |
|---|---|
| PubChem CID | 122251519 |
| Molecular Formula | C15H17F3N2O3 |
| Molecular Weight | 330.31 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | oxan-4-yl-[3-[[4-(trifluoromethyl)-2-pyridinyl]oxy]azetidin-1-yl]methanone |
| SMILES | O=C(C1CCOCC1)N1CC(Oc2cc(C(F)(F)F)ccn2)C1 |
| InChI | InChI=1S/C15H17F3N2O3/c16-15(17,18)11-1-4-19-13(7-11)23-12-8-20(9-12)14(21)10-2-5-22-6-3-10/h1,4,7,10,12H,2-3,5-6,8-9H2 |
| InChIKey | WZUPZKVEFUPLOQ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.31 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |