C22H17F3N2O3 — CID 122251942
(4-phenoxyphenyl)-[3-[[6-(trifluoromethyl)-2-pyridinyl]oxy]azetidin-1-yl]methanone (PubChem CID 122251942) has the molecular formula C22H17F3N2O3 and a molecular weight of 414.38 g/mol. Its IUPAC name is (4-phenoxyphenyl)-[3-[[6-(trifluoromethyl)-2-pyridinyl]oxy]azetidin-1-yl]methanone.
| Compound Name | (4-phenoxyphenyl)-[3-[[6-(trifluoromethyl)-2-pyridinyl]oxy]azetidin-1-yl]methanone |
|---|---|
| PubChem CID | 122251942 |
| Molecular Formula | C22H17F3N2O3 |
| Molecular Weight | 414.38 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | (4-phenoxyphenyl)-[3-[[6-(trifluoromethyl)-2-pyridinyl]oxy]azetidin-1-yl]methanone |
| SMILES | O=C(c1ccc(Oc2ccccc2)cc1)N1CC(Oc2cccc(C(F)(F)F)n2)C1 |
| InChI | InChI=1S/C22H17F3N2O3/c23-22(24,25)19-7-4-8-20(26-19)30-18-13-27(14-18)21(28)15-9-11-17(12-10-15)29-16-5-2-1-3-6-16/h1-12,18H,13-14H2 |
| InChIKey | ABGRXQUCQAFBEI-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.38 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |