C15H12ClF3N2O3S — CID 122252095
2-[1-(4-chlorophenyl)sulfonylazetidin-3-yl]oxy-6-(trifluoromethyl)pyridine (PubChem CID 122252095) has the molecular formula C15H12ClF3N2O3S and a molecular weight of 392.79 g/mol. Its IUPAC name is 2-[1-(4-chlorophenyl)sulfonylazetidin-3-yl]oxy-6-(trifluoromethyl)pyridine.
| Compound Name | 2-[1-(4-chlorophenyl)sulfonylazetidin-3-yl]oxy-6-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 122252095 |
| Molecular Formula | C15H12ClF3N2O3S |
| Molecular Weight | 392.79 g/mol |
| Exact Mass | 392.02 |
| IUPAC Name | 2-[1-(4-chlorophenyl)sulfonylazetidin-3-yl]oxy-6-(trifluoromethyl)pyridine |
| SMILES | O=S(=O)(c1ccc(Cl)cc1)N1CC(Oc2cccc(C(F)(F)F)n2)C1 |
| InChI | InChI=1S/C15H12ClF3N2O3S/c16-10-4-6-12(7-5-10)25(22,23)21-8-11(9-21)24-14-3-1-2-13(20-14)15(17,18)19/h1-7,11H,8-9H2 |
| InChIKey | CKLWLMSKYZQOFH-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.79 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |