C23H19N3O2 — CID 122252365
2-[1-(2,2-diphenylacetyl)azetidin-3-yl]oxypyridine-4-carbonitrile (PubChem CID 122252365) has the molecular formula C23H19N3O2 and a molecular weight of 369.42 g/mol. Its IUPAC name is 2-[1-(2,2-diphenylacetyl)azetidin-3-yl]oxypyridine-4-carbonitrile.
| Compound Name | 2-[1-(2,2-diphenylacetyl)azetidin-3-yl]oxypyridine-4-carbonitrile |
|---|---|
| PubChem CID | 122252365 |
| Molecular Formula | C23H19N3O2 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | 2-[1-(2,2-diphenylacetyl)azetidin-3-yl]oxypyridine-4-carbonitrile |
| SMILES | N#Cc1ccnc(OC2CN(C(=O)C(c3ccccc3)c3ccccc3)C2)c1 |
| InChI | InChI=1S/C23H19N3O2/c24-14-17-11-12-25-21(13-17)28-20-15-26(16-20)23(27)22(18-7-3-1-4-8-18)19-9-5-2-6-10-19/h1-13,20,22H,15-16H2 |
| InChIKey | FFHBCHSTCPCBLK-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 66.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |