C17H20F3N7O2 — CID 122254787
1-[[4-(dimethylamino)-6-morpholin-4-yl-1,3,5-triazin-2-yl]methyl]-3-(2,3,4-trifluorophenyl)urea (PubChem CID 122254787) has the molecular formula C17H20F3N7O2 and a molecular weight of 411.39 g/mol. Its IUPAC name is 1-[[4-(dimethylamino)-6-morpholin-4-yl-1,3,5-triazin-2-yl]methyl]-3-(2,3,4-trifluorophenyl)urea.
| Compound Name | 1-[[4-(dimethylamino)-6-morpholin-4-yl-1,3,5-triazin-2-yl]methyl]-3-(2,3,4-trifluorophenyl)urea |
|---|---|
| PubChem CID | 122254787 |
| Molecular Formula | C17H20F3N7O2 |
| Molecular Weight | 411.39 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | 1-[[4-(dimethylamino)-6-morpholin-4-yl-1,3,5-triazin-2-yl]methyl]-3-(2,3,4-trifluorophenyl)urea |
| SMILES | CN(C)c1nc(CNC(=O)Nc2ccc(F)c(F)c2F)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C17H20F3N7O2/c1-26(2)15-23-12(24-16(25-15)27-5-7-29-8-6-27)9-21-17(28)22-11-4-3-10(18)13(19)14(11)20/h3-4H,5-9H2,1-2H3,(H2,21,22,28) |
| InChIKey | QYYUOHWCVUTGIC-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 95.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.39 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|