C26H40N2O6 — CID 1222549
bis(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) benzene-1,2-dicarboxylate (PubChem CID 1222549) has the molecular formula C26H40N2O6 and a molecular weight of 476.61 g/mol. Its IUPAC name is bis(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) benzene-1,2-dicarboxylate.
| Compound Name | bis(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 1222549 |
| Molecular Formula | C26H40N2O6 |
| Molecular Weight | 476.61 g/mol |
| Exact Mass | 476.29 |
| IUPAC Name | bis(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) benzene-1,2-dicarboxylate |
| SMILES | CC1(C)CC(OC(=O)c2ccccc2C(=O)OC2CC(C)(C)N(O)C(C)(C)C2)CC(C)(C)N1O |
| InChI | InChI=1S/C26H40N2O6/c1-23(2)13-17(14-24(3,4)27(23)31)33-21(29)19-11-9-10-12-20(19)22(30)34-18-15-25(5,6)28(32)26(7,8)16-18/h9-12,17-18,31-32H,13-16H2,1-8H3 |
| InChIKey | WJZRRMYMGWLZDY-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 99.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.61 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |