C21H25ClN6O2 — CID 122255066
(E)-3-(2-chlorophenyl)-N-[(4-morpholin-4-yl-6-pyrrolidin-1-yl-1,3,5-triazin-2-yl)methyl]prop-2-enamide (PubChem CID 122255066) has the molecular formula C21H25ClN6O2 and a molecular weight of 428.92 g/mol. Its IUPAC name is (E)-3-(2-chlorophenyl)-N-[(4-morpholin-4-yl-6-pyrrolidin-1-yl-1,3,5-triazin-2-yl)methyl]prop-2-enamide.
| Compound Name | (E)-3-(2-chlorophenyl)-N-[(4-morpholin-4-yl-6-pyrrolidin-1-yl-1,3,5-triazin-2-yl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 122255066 |
| Molecular Formula | C21H25ClN6O2 |
| Molecular Weight | 428.92 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | (E)-3-(2-chlorophenyl)-N-[(4-morpholin-4-yl-6-pyrrolidin-1-yl-1,3,5-triazin-2-yl)methyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1Cl)NCc1nc(N2CCCC2)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C21H25ClN6O2/c22-17-6-2-1-5-16(17)7-8-19(29)23-15-18-24-20(27-9-3-4-10-27)26-21(25-18)28-11-13-30-14-12-28/h1-2,5-8H,3-4,9-15H2,(H,23,29)/b8-7+ |
| InChIKey | PZQRJTSELIGYLJ-BQYQJAHWSA-N |
| XLogP | 2.29 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.92 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|