C17H23ClN2O2 — CID 122256170
1-[3-[(3-chloro-4-pyridinyl)oxy]piperidin-1-yl]-2-cyclopentylethanone (PubChem CID 122256170) has the molecular formula C17H23ClN2O2 and a molecular weight of 322.84 g/mol. Its IUPAC name is 1-[3-[(3-chloro-4-pyridinyl)oxy]piperidin-1-yl]-2-cyclopentylethanone.
| Compound Name | 1-[3-[(3-chloro-4-pyridinyl)oxy]piperidin-1-yl]-2-cyclopentylethanone |
|---|---|
| PubChem CID | 122256170 |
| Molecular Formula | C17H23ClN2O2 |
| Molecular Weight | 322.84 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | 1-[3-[(3-chloro-4-pyridinyl)oxy]piperidin-1-yl]-2-cyclopentylethanone |
| SMILES | O=C(CC1CCCC1)N1CCCC(Oc2ccncc2Cl)C1 |
| InChI | InChI=1S/C17H23ClN2O2/c18-15-11-19-8-7-16(15)22-14-6-3-9-20(12-14)17(21)10-13-4-1-2-5-13/h7-8,11,13-14H,1-6,9-10,12H2 |
| InChIKey | RLBBYSPKRJJEOX-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.84 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |