C18H20N4O3S — CID 122258202
4-[3-(4,6-dimethylpyrimidin-2-yl)oxypiperidin-1-yl]sulfonylbenzonitrile (PubChem CID 122258202) has the molecular formula C18H20N4O3S and a molecular weight of 372.45 g/mol. Its IUPAC name is 4-[3-(4,6-dimethylpyrimidin-2-yl)oxypiperidin-1-yl]sulfonylbenzonitrile.
| Compound Name | 4-[3-(4,6-dimethylpyrimidin-2-yl)oxypiperidin-1-yl]sulfonylbenzonitrile |
|---|---|
| PubChem CID | 122258202 |
| Molecular Formula | C18H20N4O3S |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | 4-[3-(4,6-dimethylpyrimidin-2-yl)oxypiperidin-1-yl]sulfonylbenzonitrile |
| SMILES | Cc1cc(C)nc(OC2CCCN(S(=O)(=O)c3ccc(C#N)cc3)C2)n1 |
| InChI | InChI=1S/C18H20N4O3S/c1-13-10-14(2)21-18(20-13)25-16-4-3-9-22(12-16)26(23,24)17-7-5-15(11-19)6-8-17/h5-8,10,16H,3-4,9,12H2,1-2H3 |
| InChIKey | UOIMMORCNLWFBQ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 96.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |