C20H25N3O2S — CID 122260878
[3-(2-methylpyrimidin-4-yl)oxypiperidin-1-yl]-(1-thiophen-2-ylcyclopentyl)methanone (PubChem CID 122260878) has the molecular formula C20H25N3O2S and a molecular weight of 371.51 g/mol. Its IUPAC name is [3-(2-methylpyrimidin-4-yl)oxypiperidin-1-yl]-(1-thiophen-2-ylcyclopentyl)methanone.
| Compound Name | [3-(2-methylpyrimidin-4-yl)oxypiperidin-1-yl]-(1-thiophen-2-ylcyclopentyl)methanone |
|---|---|
| PubChem CID | 122260878 |
| Molecular Formula | C20H25N3O2S |
| Molecular Weight | 371.51 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | [3-(2-methylpyrimidin-4-yl)oxypiperidin-1-yl]-(1-thiophen-2-ylcyclopentyl)methanone |
| SMILES | Cc1nccc(OC2CCCN(C(=O)C3(c4cccs4)CCCC3)C2)n1 |
| InChI | InChI=1S/C20H25N3O2S/c1-15-21-11-8-18(22-15)25-16-6-4-12-23(14-16)19(24)20(9-2-3-10-20)17-7-5-13-26-17/h5,7-8,11,13,16H,2-4,6,9-10,12,14H2,1H3 |
| InChIKey | ABWSUHXVCRCIRU-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.51 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |