C21H23N5O3 — CID 122261217
[3-(2-methoxypyrimidin-4-yl)oxypiperidin-1-yl]-(1-methyl-3-phenylpyrazol-5-yl)methanone (PubChem CID 122261217) has the molecular formula C21H23N5O3 and a molecular weight of 393.45 g/mol. Its IUPAC name is [3-(2-methoxypyrimidin-4-yl)oxypiperidin-1-yl]-(1-methyl-3-phenylpyrazol-5-yl)methanone.
| Compound Name | [3-(2-methoxypyrimidin-4-yl)oxypiperidin-1-yl]-(1-methyl-3-phenylpyrazol-5-yl)methanone |
|---|---|
| PubChem CID | 122261217 |
| Molecular Formula | C21H23N5O3 |
| Molecular Weight | 393.45 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | [3-(2-methoxypyrimidin-4-yl)oxypiperidin-1-yl]-(1-methyl-3-phenylpyrazol-5-yl)methanone |
| SMILES | COc1nccc(OC2CCCN(C(=O)c3cc(-c4ccccc4)nn3C)C2)n1 |
| InChI | InChI=1S/C21H23N5O3/c1-25-18(13-17(24-25)15-7-4-3-5-8-15)20(27)26-12-6-9-16(14-26)29-19-10-11-22-21(23-19)28-2/h3-5,7-8,10-11,13,16H,6,9,12,14H2,1-2H3 |
| InChIKey | LBSODIFOPYLJSS-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 82.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.45 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |