C17H20N4O3S — CID 122261529
[3-(2-methoxypyrimidin-4-yl)oxypiperidin-1-yl]-(2-methylsulfanyl-3-pyridinyl)methanone (PubChem CID 122261529) has the molecular formula C17H20N4O3S and a molecular weight of 360.44 g/mol. Its IUPAC name is [3-(2-methoxypyrimidin-4-yl)oxypiperidin-1-yl]-(2-methylsulfanyl-3-pyridinyl)methanone.
| Compound Name | [3-(2-methoxypyrimidin-4-yl)oxypiperidin-1-yl]-(2-methylsulfanyl-3-pyridinyl)methanone |
|---|---|
| PubChem CID | 122261529 |
| Molecular Formula | C17H20N4O3S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | [3-(2-methoxypyrimidin-4-yl)oxypiperidin-1-yl]-(2-methylsulfanyl-3-pyridinyl)methanone |
| SMILES | COc1nccc(OC2CCCN(C(=O)c3cccnc3SC)C2)n1 |
| InChI | InChI=1S/C17H20N4O3S/c1-23-17-19-9-7-14(20-17)24-12-5-4-10-21(11-12)16(22)13-6-3-8-18-15(13)25-2/h3,6-9,12H,4-5,10-11H2,1-2H3 |
| InChIKey | BDBSCDUQDYSSLI-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 77.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |