C17H14N4O2 — CID 122261802
2-oxo-N-[(6-phenylpyrimidin-4-yl)methyl]-1H-pyridine-3-carboxamide (PubChem CID 122261802) has the molecular formula C17H14N4O2 and a molecular weight of 306.33 g/mol. Its IUPAC name is 2-oxo-N-[(6-phenylpyrimidin-4-yl)methyl]-1H-pyridine-3-carboxamide.
| Compound Name | 2-oxo-N-[(6-phenylpyrimidin-4-yl)methyl]-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 122261802 |
| Molecular Formula | C17H14N4O2 |
| Molecular Weight | 306.33 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | 2-oxo-N-[(6-phenylpyrimidin-4-yl)methyl]-1H-pyridine-3-carboxamide |
| SMILES | O=C(NCc1cc(-c2ccccc2)ncn1)c1ccc[nH]c1=O |
| InChI | InChI=1S/C17H14N4O2/c22-16-14(7-4-8-18-16)17(23)19-10-13-9-15(21-11-20-13)12-5-2-1-3-6-12/h1-9,11H,10H2,(H,18,22)(H,19,23) |
| InChIKey | XOHHGDPFMSHORB-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.33 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |