About 1-(2,3-dihydro-1,4-benzodioxin-3-yl)-N-[(6-phenylpyrimidin-4-yl)methyl]methanesulfonamide
1-(2,3-dihydro-1,4-benzodioxin-3-yl)-N-[(6-phenylpyrimidin-4-yl)methyl]methanesulfonamide (PubChem CID 122262236) has the molecular formula C20H19N3O4S
and a molecular weight of 397.46 g/mol. Its IUPAC name is 1-(2,3-dihydro-1,4-benzodioxin-3-yl)-N-[(6-phenylpyrimidin-4-yl)methyl]methanesulfonamide.
Molecular Properties
| Compound Name | 1-(2,3-dihydro-1,4-benzodioxin-3-yl)-N-[(6-phenylpyrimidin-4-yl)methyl]methanesulfonamide |
| PubChem CID | 122262236 |
| Molecular Formula | C20H19N3O4S |
| Molecular Weight | 397.46 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | 1-(2,3-dihydro-1,4-benzodioxin-3-yl)-N-[(6-phenylpyrimidin-4-yl)methyl]methanesulfonamide |
| SMILES | O=S(=O)(CC1COc2ccccc2O1)NCc1cc(-c2ccccc2)ncn1 |
| InChI | InChI=1S/C20H19N3O4S/c24-28(25,13-17-12-26-19-8-4-5-9-20(19)27-17)23-11-16-10-18(22-14-21-16)15-6-2-1-3-7-15/h1-10,14,17,23H,11-13H2 |
| InChIKey | OGTUMWSMGJYWRH-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.46 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(2,3-dihydro-1,4-benzodioxin-3-yl)-N-[(6-phenylpyrimidin-4-yl)methyl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,3-dihydro-1,4-benzodioxin-3-yl)-N-[(6-phenylpyrimidin-4-yl)methyl]methanesulfonamide?
The IUPAC name of 1-(2,3-dihydro-1,4-benzodioxin-3-yl)-N-[(6-phenylpyrimidin-4-yl)methyl]methanesulfonamide (CID 122262236) is 1-(2,3-dihydro-1,4-benzodioxin-3-yl)-N-[(6-phenylpyrimidin-4-yl)methyl]methanesulfonamide.
What is the SMILES notation for 1-(2,3-dihydro-1,4-benzodioxin-3-yl)-N-[(6-phenylpyrimidin-4-yl)methyl]methanesulfonamide?
The canonical SMILES for 1-(2,3-dihydro-1,4-benzodioxin-3-yl)-N-[(6-phenylpyrimidin-4-yl)methyl]methanesulfonamide is O=S(=O)(CC1COc2ccccc2O1)NCc1cc(-c2ccccc2)ncn1.
What is the InChIKey of 1-(2,3-dihydro-1,4-benzodioxin-3-yl)-N-[(6-phenylpyrimidin-4-yl)methyl]methanesulfonamide?
The InChIKey is OGTUMWSMGJYWRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19N3O4S/c24-28(25,13-17-12-26-19-8-4-5-9-20(19)27-17)23-11-16-10-18(22-14-21-16)15-6-2-1-3-7-15/h1-10,14,17,23H,11-13H2.
What are the key properties of 1-(2,3-dihydro-1,4-benzodioxin-3-yl)-N-[(6-phenylpyrimidin-4-yl)methyl]methanesulfonamide?
1-(2,3-dihydro-1,4-benzodioxin-3-yl)-N-[(6-phenylpyrimidin-4-yl)methyl]methanesulfonamide has a molecular weight of 397.46 g/mol, XLogP of 2.40, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,3-dihydro-1,4-benzodioxin-3-yl)-N-[(6-phenylpyrimidin-4-yl)methyl]methanesulfonamide is sourced from PubChem (CID 122262236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).