C22H17N3O4 — CID 122262283
N-[[6-(4-methoxyphenyl)pyrimidin-4-yl]methyl]-2-oxochromene-3-carboxamide (PubChem CID 122262283) has the molecular formula C22H17N3O4 and a molecular weight of 387.40 g/mol. Its IUPAC name is N-[[6-(4-methoxyphenyl)pyrimidin-4-yl]methyl]-2-oxochromene-3-carboxamide.
| Compound Name | N-[[6-(4-methoxyphenyl)pyrimidin-4-yl]methyl]-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 122262283 |
| Molecular Formula | C22H17N3O4 |
| Molecular Weight | 387.40 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | N-[[6-(4-methoxyphenyl)pyrimidin-4-yl]methyl]-2-oxochromene-3-carboxamide |
| SMILES | COc1ccc(-c2cc(CNC(=O)c3cc4ccccc4oc3=O)ncn2)cc1 |
| InChI | InChI=1S/C22H17N3O4/c1-28-17-8-6-14(7-9-17)19-11-16(24-13-25-19)12-23-21(26)18-10-15-4-2-3-5-20(15)29-22(18)27/h2-11,13H,12H2,1H3,(H,23,26) |
| InChIKey | AHIQAPBMHBTATL-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.40 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|