C18H24N4O2S — CID 122264910
N'-cyclopentyl-N-[2-(3,5-dimethylpyrazol-1-yl)-2-thiophen-2-ylethyl]oxamide (PubChem CID 122264910) has the molecular formula C18H24N4O2S and a molecular weight of 360.48 g/mol. Its IUPAC name is N'-cyclopentyl-N-[2-(3,5-dimethylpyrazol-1-yl)-2-thiophen-2-ylethyl]oxamide.
| Compound Name | N'-cyclopentyl-N-[2-(3,5-dimethylpyrazol-1-yl)-2-thiophen-2-ylethyl]oxamide |
|---|---|
| PubChem CID | 122264910 |
| Molecular Formula | C18H24N4O2S |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | N'-cyclopentyl-N-[2-(3,5-dimethylpyrazol-1-yl)-2-thiophen-2-ylethyl]oxamide |
| SMILES | Cc1cc(C)n(C(CNC(=O)C(=O)NC2CCCC2)c2cccs2)n1 |
| InChI | InChI=1S/C18H24N4O2S/c1-12-10-13(2)22(21-12)15(16-8-5-9-25-16)11-19-17(23)18(24)20-14-6-3-4-7-14/h5,8-10,14-15H,3-4,6-7,11H2,1-2H3,(H,19,23)(H,20,24) |
| InChIKey | ORXSDKHAOLSBOU-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|