C22H25N3O4 — CID 122265611
(E)-3-(3,4-dimethoxyphenyl)-N-[2-(3,5-dimethylpyrazol-1-yl)-2-(furan-2-yl)ethyl]prop-2-enamide (PubChem CID 122265611) has the molecular formula C22H25N3O4 and a molecular weight of 395.46 g/mol. Its IUPAC name is (E)-3-(3,4-dimethoxyphenyl)-N-[2-(3,5-dimethylpyrazol-1-yl)-2-(furan-2-yl)ethyl]prop-2-enamide.
| Compound Name | (E)-3-(3,4-dimethoxyphenyl)-N-[2-(3,5-dimethylpyrazol-1-yl)-2-(furan-2-yl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 122265611 |
| Molecular Formula | C22H25N3O4 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | (E)-3-(3,4-dimethoxyphenyl)-N-[2-(3,5-dimethylpyrazol-1-yl)-2-(furan-2-yl)ethyl]prop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)NCC(c2ccco2)n2nc(C)cc2C)cc1OC |
| InChI | InChI=1S/C22H25N3O4/c1-15-12-16(2)25(24-15)18(19-6-5-11-29-19)14-23-22(26)10-8-17-7-9-20(27-3)21(13-17)28-4/h5-13,18H,14H2,1-4H3,(H,23,26)/b10-8+ |
| InChIKey | DNQZJBIITSUXCY-CSKARUKUSA-N |
| XLogP | 3.53 |
| TPSA | 78.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|