C19H18F2N4O3 — CID 122265850
N'-(2,5-difluorophenyl)-N-[2-(3,5-dimethylpyrazol-1-yl)-2-(furan-2-yl)ethyl]oxamide (PubChem CID 122265850) has the molecular formula C19H18F2N4O3 and a molecular weight of 388.37 g/mol. Its IUPAC name is N'-(2,5-difluorophenyl)-N-[2-(3,5-dimethylpyrazol-1-yl)-2-(furan-2-yl)ethyl]oxamide.
| Compound Name | N'-(2,5-difluorophenyl)-N-[2-(3,5-dimethylpyrazol-1-yl)-2-(furan-2-yl)ethyl]oxamide |
|---|---|
| PubChem CID | 122265850 |
| Molecular Formula | C19H18F2N4O3 |
| Molecular Weight | 388.37 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | N'-(2,5-difluorophenyl)-N-[2-(3,5-dimethylpyrazol-1-yl)-2-(furan-2-yl)ethyl]oxamide |
| SMILES | Cc1cc(C)n(C(CNC(=O)C(=O)Nc2cc(F)ccc2F)c2ccco2)n1 |
| InChI | InChI=1S/C19H18F2N4O3/c1-11-8-12(2)25(24-11)16(17-4-3-7-28-17)10-22-18(26)19(27)23-15-9-13(20)5-6-14(15)21/h3-9,16H,10H2,1-2H3,(H,22,26)(H,23,27) |
| InChIKey | HLMGPGMDAWBFHF-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 89.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.37 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|