About Viloxazine, (S)-
Viloxazine, (S)- (PubChem CID 12226598) has the molecular formula C13H19NO3
and a molecular weight of 237.29 g/mol. Its IUPAC name is (2S)-2-[(2-ethoxyphenoxy)methyl]morpholine.
Molecular Properties
| Compound Name | Viloxazine, (S)- |
| PubChem CID | 12226598 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.29 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | (2S)-2-[(2-ethoxyphenoxy)methyl]morpholine |
| SMILES | CCOC1=CC=CC=C1OC[C@@H]2CNCCO2 |
| InChI | InChI=1S/C13H19NO3/c1-2-15-12-5-3-4-6-13(12)17-10-11-9-14-7-8-16-11/h3-6,11,14H,2,7-10H2,1H3/t11-/m0/s1 |
| InChIKey | YWPHCCPCQOJSGZ-NSHDSACASA-N |
| XLogP | 1.50 |
| TPSA | 39.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | 213 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.29 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze Viloxazine, (S)- with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Viloxazine, (S)-?
The IUPAC name of Viloxazine, (S)- (CID 12226598) is (2S)-2-[(2-ethoxyphenoxy)methyl]morpholine.
What is the SMILES notation for Viloxazine, (S)-?
The canonical SMILES for Viloxazine, (S)- is CCOC1=CC=CC=C1OC[C@@H]2CNCCO2.
What is the InChIKey of Viloxazine, (S)-?
The InChIKey is YWPHCCPCQOJSGZ-NSHDSACASA-N. The full InChI is InChI=1S/C13H19NO3/c1-2-15-12-5-3-4-6-13(12)17-10-11-9-14-7-8-16-11/h3-6,11,14H,2,7-10H2,1H3/t11-/m0/s1.
What are the key properties of Viloxazine, (S)-?
Viloxazine, (S)- has a molecular weight of 237.29 g/mol, XLogP of 1.50, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for Viloxazine, (S)- is sourced from PubChem (CID 12226598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).