C22H26N4O2 — CID 122267952
1-[3-(5-ethylpyrimidin-2-yl)oxypiperidin-1-yl]-2-(1-methylindol-3-yl)ethanone (PubChem CID 122267952) has the molecular formula C22H26N4O2 and a molecular weight of 378.48 g/mol. Its IUPAC name is 1-[3-(5-ethylpyrimidin-2-yl)oxypiperidin-1-yl]-2-(1-methylindol-3-yl)ethanone.
| Compound Name | 1-[3-(5-ethylpyrimidin-2-yl)oxypiperidin-1-yl]-2-(1-methylindol-3-yl)ethanone |
|---|---|
| PubChem CID | 122267952 |
| Molecular Formula | C22H26N4O2 |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | 1-[3-(5-ethylpyrimidin-2-yl)oxypiperidin-1-yl]-2-(1-methylindol-3-yl)ethanone |
| SMILES | CCc1cnc(OC2CCCN(C(=O)Cc3cn(C)c4ccccc34)C2)nc1 |
| InChI | InChI=1S/C22H26N4O2/c1-3-16-12-23-22(24-13-16)28-18-7-6-10-26(15-18)21(27)11-17-14-25(2)20-9-5-4-8-19(17)20/h4-5,8-9,12-14,18H,3,6-7,10-11,15H2,1-2H3 |
| InChIKey | TZZMKTXFRUWEPK-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |