About 2-(3,3-difluoropyrrolidin-1-yl)pyrazine
2-(3,3-difluoropyrrolidin-1-yl)pyrazine (PubChem CID 122269216) has the molecular formula C8H9F2N3
and a molecular weight of 185.18 g/mol. Its IUPAC name is 2-(3,3-difluoropyrrolidin-1-yl)pyrazine.
Molecular Properties
| Compound Name | 2-(3,3-difluoropyrrolidin-1-yl)pyrazine |
| PubChem CID | 122269216 |
| Molecular Formula | C8H9F2N3 |
| Molecular Weight | 185.18 g/mol |
| Exact Mass | 185.08 |
| IUPAC Name | 2-(3,3-difluoropyrrolidin-1-yl)pyrazine |
| SMILES | FC1(F)CCN(c2cnccn2)C1 |
| InChI | InChI=1S/C8H9F2N3/c9-8(10)1-4-13(6-8)7-5-11-2-3-12-7/h2-3,5H,1,4,6H2 |
| InChIKey | CTZNFXOJALNBOT-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.18 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(3,3-difluoropyrrolidin-1-yl)pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,3-difluoropyrrolidin-1-yl)pyrazine?
The IUPAC name of 2-(3,3-difluoropyrrolidin-1-yl)pyrazine (CID 122269216) is 2-(3,3-difluoropyrrolidin-1-yl)pyrazine.
What is the SMILES notation for 2-(3,3-difluoropyrrolidin-1-yl)pyrazine?
The canonical SMILES for 2-(3,3-difluoropyrrolidin-1-yl)pyrazine is FC1(F)CCN(c2cnccn2)C1.
What is the InChIKey of 2-(3,3-difluoropyrrolidin-1-yl)pyrazine?
The InChIKey is CTZNFXOJALNBOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9F2N3/c9-8(10)1-4-13(6-8)7-5-11-2-3-12-7/h2-3,5H,1,4,6H2.
What are the key properties of 2-(3,3-difluoropyrrolidin-1-yl)pyrazine?
2-(3,3-difluoropyrrolidin-1-yl)pyrazine has a molecular weight of 185.18 g/mol, XLogP of 1.32, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,3-difluoropyrrolidin-1-yl)pyrazine is sourced from PubChem (CID 122269216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).