About N-tert-butyl-3,3-difluoropyrrolidine-1-carboxamide
N-tert-butyl-3,3-difluoropyrrolidine-1-carboxamide (PubChem CID 122269282) has the molecular formula C9H16F2N2O
and a molecular weight of 206.24 g/mol. Its IUPAC name is N-tert-butyl-3,3-difluoropyrrolidine-1-carboxamide.
Molecular Properties
| Compound Name | N-tert-butyl-3,3-difluoropyrrolidine-1-carboxamide |
| PubChem CID | 122269282 |
| Molecular Formula | C9H16F2N2O |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | N-tert-butyl-3,3-difluoropyrrolidine-1-carboxamide |
| SMILES | CC(C)(C)NC(=O)N1CCC(F)(F)C1 |
| InChI | InChI=1S/C9H16F2N2O/c1-8(2,3)12-7(14)13-5-4-9(10,11)6-13/h4-6H2,1-3H3,(H,12,14) |
| InChIKey | SOJYPDLCIJIVEC-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-tert-butyl-3,3-difluoropyrrolidine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-3,3-difluoropyrrolidine-1-carboxamide?
The IUPAC name of N-tert-butyl-3,3-difluoropyrrolidine-1-carboxamide (CID 122269282) is N-tert-butyl-3,3-difluoropyrrolidine-1-carboxamide.
What is the SMILES notation for N-tert-butyl-3,3-difluoropyrrolidine-1-carboxamide?
The canonical SMILES for N-tert-butyl-3,3-difluoropyrrolidine-1-carboxamide is CC(C)(C)NC(=O)N1CCC(F)(F)C1.
What is the InChIKey of N-tert-butyl-3,3-difluoropyrrolidine-1-carboxamide?
The InChIKey is SOJYPDLCIJIVEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16F2N2O/c1-8(2,3)12-7(14)13-5-4-9(10,11)6-13/h4-6H2,1-3H3,(H,12,14).
What are the key properties of N-tert-butyl-3,3-difluoropyrrolidine-1-carboxamide?
N-tert-butyl-3,3-difluoropyrrolidine-1-carboxamide has a molecular weight of 206.24 g/mol, XLogP of 1.84, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-3,3-difluoropyrrolidine-1-carboxamide is sourced from PubChem (CID 122269282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).