C9H14F2N2O2 — CID 122269488
3,3-difluoro-N-(oxolan-2-ylmethyl)azetidine-1-carboxamide (PubChem CID 122269488) has the molecular formula C9H14F2N2O2 and a molecular weight of 220.22 g/mol. Its IUPAC name is 3,3-difluoro-N-(oxolan-2-ylmethyl)azetidine-1-carboxamide.
| Compound Name | 3,3-difluoro-N-(oxolan-2-ylmethyl)azetidine-1-carboxamide |
|---|---|
| PubChem CID | 122269488 |
| Molecular Formula | C9H14F2N2O2 |
| Molecular Weight | 220.22 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | 3,3-difluoro-N-(oxolan-2-ylmethyl)azetidine-1-carboxamide |
| SMILES | O=C(NCC1CCCO1)N1CC(F)(F)C1 |
| InChI | InChI=1S/C9H14F2N2O2/c10-9(11)5-13(6-9)8(14)12-4-7-2-1-3-15-7/h7H,1-6H2,(H,12,14) |
| InChIKey | GWUWAKJELSIKSE-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.22 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |