About 1-cyclopropylsulfonyl-3,3-difluoroazetidine
1-cyclopropylsulfonyl-3,3-difluoroazetidine (PubChem CID 122269491) has the molecular formula C6H9F2NO2S
and a molecular weight of 197.21 g/mol. Its IUPAC name is 1-cyclopropylsulfonyl-3,3-difluoroazetidine.
Molecular Properties
| Compound Name | 1-cyclopropylsulfonyl-3,3-difluoroazetidine |
| PubChem CID | 122269491 |
| Molecular Formula | C6H9F2NO2S |
| Molecular Weight | 197.21 g/mol |
| Exact Mass | 197.03 |
| IUPAC Name | 1-cyclopropylsulfonyl-3,3-difluoroazetidine |
| SMILES | O=S(=O)(C1CC1)N1CC(F)(F)C1 |
| InChI | InChI=1S/C6H9F2NO2S/c7-6(8)3-9(4-6)12(10,11)5-1-2-5/h5H,1-4H2 |
| InChIKey | IUIPGXWHOFBKEQ-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.21 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-cyclopropylsulfonyl-3,3-difluoroazetidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopropylsulfonyl-3,3-difluoroazetidine?
The IUPAC name of 1-cyclopropylsulfonyl-3,3-difluoroazetidine (CID 122269491) is 1-cyclopropylsulfonyl-3,3-difluoroazetidine.
What is the SMILES notation for 1-cyclopropylsulfonyl-3,3-difluoroazetidine?
The canonical SMILES for 1-cyclopropylsulfonyl-3,3-difluoroazetidine is O=S(=O)(C1CC1)N1CC(F)(F)C1.
What is the InChIKey of 1-cyclopropylsulfonyl-3,3-difluoroazetidine?
The InChIKey is IUIPGXWHOFBKEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9F2NO2S/c7-6(8)3-9(4-6)12(10,11)5-1-2-5/h5H,1-4H2.
What are the key properties of 1-cyclopropylsulfonyl-3,3-difluoroazetidine?
1-cyclopropylsulfonyl-3,3-difluoroazetidine has a molecular weight of 197.21 g/mol, XLogP of 0.43, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopropylsulfonyl-3,3-difluoroazetidine is sourced from PubChem (CID 122269491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).