About 5-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-2-oxa-5-azabicyclo[2.2.1]heptane
5-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-2-oxa-5-azabicyclo[2.2.1]heptane (PubChem CID 122269719) has the molecular formula C11H16N2O2
and a molecular weight of 208.26 g/mol. Its IUPAC name is 5-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-2-oxa-5-azabicyclo[2.2.1]heptane.
Molecular Properties
| Compound Name | 5-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-2-oxa-5-azabicyclo[2.2.1]heptane |
| PubChem CID | 122269719 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | 5-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-2-oxa-5-azabicyclo[2.2.1]heptane |
| SMILES | Cc1noc(C)c1CN1CC2CC1CO2 |
| InChI | InChI=1S/C11H16N2O2/c1-7-11(8(2)15-12-7)5-13-4-10-3-9(13)6-14-10/h9-10H,3-6H2,1-2H3 |
| InChIKey | UGEKEOMCVZYQNO-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 38.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-2-oxa-5-azabicyclo[2.2.1]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-2-oxa-5-azabicyclo[2.2.1]heptane?
The IUPAC name of 5-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-2-oxa-5-azabicyclo[2.2.1]heptane (CID 122269719) is 5-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-2-oxa-5-azabicyclo[2.2.1]heptane.
What is the SMILES notation for 5-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-2-oxa-5-azabicyclo[2.2.1]heptane?
The canonical SMILES for 5-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-2-oxa-5-azabicyclo[2.2.1]heptane is Cc1noc(C)c1CN1CC2CC1CO2.
What is the InChIKey of 5-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-2-oxa-5-azabicyclo[2.2.1]heptane?
The InChIKey is UGEKEOMCVZYQNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2O2/c1-7-11(8(2)15-12-7)5-13-4-10-3-9(13)6-14-10/h9-10H,3-6H2,1-2H3.
What are the key properties of 5-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-2-oxa-5-azabicyclo[2.2.1]heptane?
5-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-2-oxa-5-azabicyclo[2.2.1]heptane has a molecular weight of 208.26 g/mol, XLogP of 1.26, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-2-oxa-5-azabicyclo[2.2.1]heptane is sourced from PubChem (CID 122269719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).