C12H13F2N3 — CID 122270125
2-[3-(difluoromethyl)azetidin-1-yl]-1-methylbenzimidazole (PubChem CID 122270125) has the molecular formula C12H13F2N3 and a molecular weight of 237.25 g/mol. Its IUPAC name is 2-[3-(difluoromethyl)azetidin-1-yl]-1-methylbenzimidazole.
| Compound Name | 2-[3-(difluoromethyl)azetidin-1-yl]-1-methylbenzimidazole |
|---|---|
| PubChem CID | 122270125 |
| Molecular Formula | C12H13F2N3 |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.11 |
| IUPAC Name | 2-[3-(difluoromethyl)azetidin-1-yl]-1-methylbenzimidazole |
| SMILES | Cn1c(N2CC(C(F)F)C2)nc2ccccc21 |
| InChI | InChI=1S/C12H13F2N3/c1-16-10-5-3-2-4-9(10)15-12(16)17-6-8(7-17)11(13)14/h2-5,8,11H,6-7H2,1H3 |
| InChIKey | CSQNQVSLHHNTSG-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.25 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |