C16H22N4O — CID 122274470
2-ethyl-N-[[6-(1-methylpyrazol-4-yl)-3-pyridinyl]methyl]butanamide (PubChem CID 122274470) has the molecular formula C16H22N4O and a molecular weight of 286.38 g/mol. Its IUPAC name is 2-ethyl-N-[[6-(1-methylpyrazol-4-yl)-3-pyridinyl]methyl]butanamide.
| Compound Name | 2-ethyl-N-[[6-(1-methylpyrazol-4-yl)-3-pyridinyl]methyl]butanamide |
|---|---|
| PubChem CID | 122274470 |
| Molecular Formula | C16H22N4O |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | 2-ethyl-N-[[6-(1-methylpyrazol-4-yl)-3-pyridinyl]methyl]butanamide |
| SMILES | CCC(CC)C(=O)NCc1ccc(-c2cnn(C)c2)nc1 |
| InChI | InChI=1S/C16H22N4O/c1-4-13(5-2)16(21)18-9-12-6-7-15(17-8-12)14-10-19-20(3)11-14/h6-8,10-11,13H,4-5,9H2,1-3H3,(H,18,21) |
| InChIKey | QLLGQHZOCNSUGA-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |