About cyclobutylmethyl 3-[(2,4-dioxo-1,3-oxazolidin-3-yl)methyl]azetidine-1-carboxylate
cyclobutylmethyl 3-[(2,4-dioxo-1,3-oxazolidin-3-yl)methyl]azetidine-1-carboxylate (PubChem CID 122275018) has the molecular formula C13H18N2O5
and a molecular weight of 282.30 g/mol. Its IUPAC name is cyclobutylmethyl 3-[(2,4-dioxo-1,3-oxazolidin-3-yl)methyl]azetidine-1-carboxylate.
Molecular Properties
| Compound Name | cyclobutylmethyl 3-[(2,4-dioxo-1,3-oxazolidin-3-yl)methyl]azetidine-1-carboxylate |
| PubChem CID | 122275018 |
| Molecular Formula | C13H18N2O5 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | cyclobutylmethyl 3-[(2,4-dioxo-1,3-oxazolidin-3-yl)methyl]azetidine-1-carboxylate |
| SMILES | O=C(OCC1CCC1)N1CC(CN2C(=O)COC2=O)C1 |
| InChI | InChI=1S/C13H18N2O5/c16-11-8-20-13(18)15(11)6-10-4-14(5-10)12(17)19-7-9-2-1-3-9/h9-10H,1-8H2 |
| InChIKey | HIYJCUVXVIQIBP-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze cyclobutylmethyl 3-[(2,4-dioxo-1,3-oxazolidin-3-yl)methyl]azetidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclobutylmethyl 3-[(2,4-dioxo-1,3-oxazolidin-3-yl)methyl]azetidine-1-carboxylate?
The IUPAC name of cyclobutylmethyl 3-[(2,4-dioxo-1,3-oxazolidin-3-yl)methyl]azetidine-1-carboxylate (CID 122275018) is cyclobutylmethyl 3-[(2,4-dioxo-1,3-oxazolidin-3-yl)methyl]azetidine-1-carboxylate.
What is the SMILES notation for cyclobutylmethyl 3-[(2,4-dioxo-1,3-oxazolidin-3-yl)methyl]azetidine-1-carboxylate?
The canonical SMILES for cyclobutylmethyl 3-[(2,4-dioxo-1,3-oxazolidin-3-yl)methyl]azetidine-1-carboxylate is O=C(OCC1CCC1)N1CC(CN2C(=O)COC2=O)C1.
What is the InChIKey of cyclobutylmethyl 3-[(2,4-dioxo-1,3-oxazolidin-3-yl)methyl]azetidine-1-carboxylate?
The InChIKey is HIYJCUVXVIQIBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2O5/c16-11-8-20-13(18)15(11)6-10-4-14(5-10)12(17)19-7-9-2-1-3-9/h9-10H,1-8H2.
What are the key properties of cyclobutylmethyl 3-[(2,4-dioxo-1,3-oxazolidin-3-yl)methyl]azetidine-1-carboxylate?
cyclobutylmethyl 3-[(2,4-dioxo-1,3-oxazolidin-3-yl)methyl]azetidine-1-carboxylate has a molecular weight of 282.30 g/mol, XLogP of 0.83, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for cyclobutylmethyl 3-[(2,4-dioxo-1,3-oxazolidin-3-yl)methyl]azetidine-1-carboxylate is sourced from PubChem (CID 122275018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).