C20H17N5O3 — CID 122275349
2-(1,3-dioxoisoindol-2-yl)-N-[[2-(1-methylpyrazol-4-yl)-3-pyridinyl]methyl]acetamide (PubChem CID 122275349) has the molecular formula C20H17N5O3 and a molecular weight of 375.39 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-N-[[2-(1-methylpyrazol-4-yl)-3-pyridinyl]methyl]acetamide.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-N-[[2-(1-methylpyrazol-4-yl)-3-pyridinyl]methyl]acetamide |
|---|---|
| PubChem CID | 122275349 |
| Molecular Formula | C20H17N5O3 |
| Molecular Weight | 375.39 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-N-[[2-(1-methylpyrazol-4-yl)-3-pyridinyl]methyl]acetamide |
| SMILES | Cn1cc(-c2ncccc2CNC(=O)CN2C(=O)c3ccccc3C2=O)cn1 |
| InChI | InChI=1S/C20H17N5O3/c1-24-11-14(10-23-24)18-13(5-4-8-21-18)9-22-17(26)12-25-19(27)15-6-2-3-7-16(15)20(25)28/h2-8,10-11H,9,12H2,1H3,(H,22,26) |
| InChIKey | LCZFMTHZVCHBDL-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.39 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|