C14H13BrN4O2S2 — CID 122275603
5-bromo-N-[[2-(1-methylpyrazol-4-yl)-3-pyridinyl]methyl]thiophene-2-sulfonamide (PubChem CID 122275603) has the molecular formula C14H13BrN4O2S2 and a molecular weight of 413.32 g/mol. Its IUPAC name is 5-bromo-N-[[2-(1-methylpyrazol-4-yl)-3-pyridinyl]methyl]thiophene-2-sulfonamide.
| Compound Name | 5-bromo-N-[[2-(1-methylpyrazol-4-yl)-3-pyridinyl]methyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 122275603 |
| Molecular Formula | C14H13BrN4O2S2 |
| Molecular Weight | 413.32 g/mol |
| Exact Mass | 411.97 |
| IUPAC Name | 5-bromo-N-[[2-(1-methylpyrazol-4-yl)-3-pyridinyl]methyl]thiophene-2-sulfonamide |
| SMILES | Cn1cc(-c2ncccc2CNS(=O)(=O)c2ccc(Br)s2)cn1 |
| InChI | InChI=1S/C14H13BrN4O2S2/c1-19-9-11(7-17-19)14-10(3-2-6-16-14)8-18-23(20,21)13-5-4-12(15)22-13/h2-7,9,18H,8H2,1H3 |
| InChIKey | LGVBNIYUCQBJHV-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.32 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |